CAS 1253910-15-4 is the registry number for DL-threo-4-fluoromethylphenidate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 100mg.
Methyl (2R)-2-(4-fluorophenyl)-2-[(2R)-piperidin-2-yl]acetate (CAS 1253910-15-4) is a chemical compound with the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. IUPAC name: methyl (2R)-2-(4-fluorophenyl)-2-[(2R)-piperidin-2-yl]acetate. InChIKey: XISBAJBPDVRSPG-CHWSQXEVSA-N.
| Molecular formula | C14H18FNO2 |
|---|---|
| Molecular weight | 251.30 g/mol |
| IUPAC name | methyl (2R)-2-(4-fluorophenyl)-2-[(2R)-piperidin-2-yl]acetate |
| InChIKey | XISBAJBPDVRSPG-CHWSQXEVSA-N |
| SMILES | COC(=O)[C@@H]([C@H]1CCCCN1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)