Products 1354631-33-6

CAS 1354631-33-6 is the registry number for Methyl 2-(4-fluorophenyl)-2-(piperidin-2-yl)acetate. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2-(4-fluorophenyl)-2-piperidin-2-ylacetate (CAS 1354631-33-6) is a chemical compound with the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. IUPAC name: methyl 2-(4-fluorophenyl)-2-piperidin-2-ylacetate. InChIKey: XISBAJBPDVRSPG-UHFFFAOYSA-N.

Identity
Molecular formulaC14H18FNO2
Molecular weight251.30 g/mol
IUPAC namemethyl 2-(4-fluorophenyl)-2-piperidin-2-ylacetate
InChIKeyXISBAJBPDVRSPG-UHFFFAOYSA-N
SMILESCOC(=O)C(C1CCCCN1)C2=CC=C(C=C2)F

Computed by PubChem (NCBI)