Products 1253912-15-0

CAS 1253912-15-0 is the registry number for Indolin-6-ylboronic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 50mg.

Structural formula: {0} (CAS {1})

2,3-dihydro-1H-indol-6-ylboronic acid (CAS 1253912-15-0) is a chemical compound with the molecular formula C8H10BNO2 and a molecular weight of 162.98 g/mol. IUPAC name: 2,3-dihydro-1H-indol-6-ylboronic acid. InChIKey: AKTWHCRFKCLLCJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10BNO2
Molecular weight162.98 g/mol
IUPAC name2,3-dihydro-1H-indol-6-ylboronic acid
InChIKeyAKTWHCRFKCLLCJ-UHFFFAOYSA-N
SMILESB(C1=CC2=C(CCN2)C=C1)(O)O

Computed by PubChem (NCBI)