CAS 1253912-15-0 is the registry number for Indolin-6-ylboronic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 50mg.
2,3-dihydro-1H-indol-6-ylboronic acid (CAS 1253912-15-0) is a chemical compound with the molecular formula C8H10BNO2 and a molecular weight of 162.98 g/mol. IUPAC name: 2,3-dihydro-1H-indol-6-ylboronic acid. InChIKey: AKTWHCRFKCLLCJ-UHFFFAOYSA-N.
| Molecular formula | C8H10BNO2 |
|---|---|
| Molecular weight | 162.98 g/mol |
| IUPAC name | 2,3-dihydro-1H-indol-6-ylboronic acid |
| InChIKey | AKTWHCRFKCLLCJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(CCN2)C=C1)(O)O |
Computed by PubChem (NCBI)