Products 2803902-90-9

CAS 2803902-90-9 is the registry number for rel-((1R,2R)-2-(Pyridin-4-yl)cyclopropyl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[(1R,2R)-2-pyridin-4-ylcyclopropyl]boronic acid (CAS 2803902-90-9) is a chemical compound with the molecular formula C8H10BNO2 and a molecular weight of 162.98 g/mol. IUPAC name: [(1R,2R)-2-pyridin-4-ylcyclopropyl]boronic acid. InChIKey: NXOGFXHPFFEEEY-JGVFFNPUSA-N.

Identity
Molecular formulaC8H10BNO2
Molecular weight162.98 g/mol
IUPAC name[(1R,2R)-2-pyridin-4-ylcyclopropyl]boronic acid
InChIKeyNXOGFXHPFFEEEY-JGVFFNPUSA-N
SMILESB([C@@H]1C[C@H]1C2=CC=NC=C2)(O)O

Computed by PubChem (NCBI)