CAS 1262279-06-0 is the registry number for 6-(Aminomethyl)-1,3-dihydro-2,1-benzoxaborol-1-ol. Offered by: TRC. Available pack sizes: 250mg.
(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methanamine (CAS 1262279-06-0) is a chemical compound with the molecular formula C8H10BNO2 and a molecular weight of 162.98 g/mol. IUPAC name: (1-hydroxy-3H-2,1-benzoxaborol-6-yl)methanamine. InChIKey: BZQYHQXQCMJSLP-UHFFFAOYSA-N.
| Molecular formula | C8H10BNO2 |
|---|---|
| Molecular weight | 162.98 g/mol |
| IUPAC name | (1-hydroxy-3H-2,1-benzoxaborol-6-yl)methanamine |
| InChIKey | BZQYHQXQCMJSLP-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C=CC(=C2)CN)O |
Computed by PubChem (NCBI)