CAS 1335095-08-3 appears in our catalog under these names: 7-Amino-3,4-dihydro-1H-2,1-benzoxaborinin-1-ol, 95%, 7-Amino-3,4-dihydro-1H-2,1-benzoxaborinin-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-amine (CAS 1335095-08-3) is a chemical compound with the molecular formula C8H10BNO2 and a molecular weight of 162.98 g/mol. IUPAC name: 1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-amine. InChIKey: FAFYNSWNCDQADT-UHFFFAOYSA-N.
| Molecular formula | C8H10BNO2 |
|---|---|
| Molecular weight | 162.98 g/mol |
| IUPAC name | 1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-amine |
| InChIKey | FAFYNSWNCDQADT-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CCO1)C=CC(=C2)N)O |
Computed by PubChem (NCBI)