Products 1253964-00-9
CAS 1253964-00-9 is the registry number for 1,1-Dimethylethyl 4-oxo-2-thioxo-1-imidazolidinecarboxylate, 99%, 99%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 4-oxo-2-sulfanylideneimidazolidine-1-carboxylate (CAS 1253964-00-9) is a chemical compound with the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. IUPAC name: tert-butyl 4-oxo-2-sulfanylideneimidazolidine-1-carboxylate. InChIKey: MWELBUZHQSTTFM-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O3S |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | tert-butyl 4-oxo-2-sulfanylideneimidazolidine-1-carboxylate |
| InChIKey | MWELBUZHQSTTFM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)NC1=S |
Computed by PubChem (NCBI)