Products 1254073-62-5
CAS 1254073-62-5 appears in our catalog under these names: 2,3-Dichloro-4-methylbenzoic acid, 95%, 2，3–Dichloro–4–methylbenzoic acid, 2,3-Dichloro-4-methylbenzoic acid, 2,3-Dichloro-4-methylbenzoic acid, ≥95%, ≥95%, 2,3-Dichloro-4-methylbenzoic acid, ≥95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 0,5g, 0,25g, 1g, 2g, 5g.
2,3-dichloro-4-methylbenzoic acid (CAS 1254073-62-5) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 2,3-dichloro-4-methylbenzoic acid. InChIKey: PBUDJTSPOLSTQE-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 2,3-dichloro-4-methylbenzoic acid |
| InChIKey | PBUDJTSPOLSTQE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)