CAS 1254118-35-8 appears in our catalog under these names: 3-(Difluoromethyl)-4-fluorophenylboronic acid, 95%, (3–(Difluoromethyl)–4–fluorophenyl)boronic acid, (3-(difluoromethyl)-4-fluorophenyl)boronic acid 98%, (3-(difluoroMethyl)-4-fluorophenyl)boronic acid, 96%, 96%, (3-(Difluoromethyl)-4-fluorophenyl)boronic acid, 96%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 500mg.
[3-(difluoromethyl)-4-fluorophenyl]boronic acid (CAS 1254118-35-8) is a chemical compound with the molecular formula C7H6BF3O2 and a molecular weight of 189.93 g/mol. IUPAC name: [3-(difluoromethyl)-4-fluorophenyl]boronic acid. InChIKey: SZVBSEHYKANIRO-UHFFFAOYSA-N.
| Molecular formula | C7H6BF3O2 |
|---|---|
| Molecular weight | 189.93 g/mol |
| IUPAC name | [3-(difluoromethyl)-4-fluorophenyl]boronic acid |
| InChIKey | SZVBSEHYKANIRO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)C(F)F)(O)O |
Computed by PubChem (NCBI)