Products 3004963-62-3
CAS 3004963-62-3 is the registry number for (2,3,4-Trifluoro-5-methylphenyl)boronic acid, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 5g.
(2,3,4-trifluoro-5-methylphenyl)boronic acid (CAS 3004963-62-3) is a chemical compound with the molecular formula C7H6BF3O2 and a molecular weight of 189.93 g/mol. IUPAC name: (2,3,4-trifluoro-5-methylphenyl)boronic acid. InChIKey: KJTINWJZYJJMLA-UHFFFAOYSA-N.
| Molecular formula | C7H6BF3O2 |
|---|---|
| Molecular weight | 189.93 g/mol |
| IUPAC name | (2,3,4-trifluoro-5-methylphenyl)boronic acid |
| InChIKey | KJTINWJZYJJMLA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1F)F)F)C)(O)O |
Computed by PubChem (NCBI)