CAS 1254118-36-9 appears in our catalog under these names: (4-(Difluoromethyl)-3-fluorophenyl)boronic acid, 97%, (4-(Difluoromethyl)-3-fluorophenyl)boronic acid, 98%, 98%. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 5g, 250mg, 1g, 100mg.
[4-(difluoromethyl)-3-fluorophenyl]boronic acid (CAS 1254118-36-9) is a chemical compound with the molecular formula C7H6BF3O2 and a molecular weight of 189.93 g/mol. IUPAC name: [4-(difluoromethyl)-3-fluorophenyl]boronic acid. InChIKey: BNOXLKPKFHZQIW-UHFFFAOYSA-N.
| Molecular formula | C7H6BF3O2 |
|---|---|
| Molecular weight | 189.93 g/mol |
| IUPAC name | [4-(difluoromethyl)-3-fluorophenyl]boronic acid |
| InChIKey | BNOXLKPKFHZQIW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(F)F)F)(O)O |
Computed by PubChem (NCBI)