CAS 1423-27-4 appears in our catalog under these names: 2–(Trifluoromethyl)phenylboronic acid, 2-Trifluoromethylphenylboronic acid/ 95+%, 2-(Trifluoromethyl)benzeneboronic acid, 97% , 2-(Trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride), (2-Trifluoromethyl)phenylboronic acid, 98%, 98%. Offered by: GLPBio, Chemat, Thermo Scientific (Alfa Aesar), TCI, Fluorochem. Available pack sizes: 100g, 25g, 1g, 5g, 10g, 50g, 250g, 500g.
[2-(trifluoromethyl)phenyl]boronic acid (CAS 1423-27-4) is a chemical compound with the molecular formula C7H6BF3O2 and a molecular weight of 189.93 g/mol. IUPAC name: [2-(trifluoromethyl)phenyl]boronic acid. InChIKey: JNSBEPKGFVENFS-UHFFFAOYSA-N.
| Molecular formula | C7H6BF3O2 |
|---|---|
| Molecular weight | 189.93 g/mol |
| IUPAC name | [2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | JNSBEPKGFVENFS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1C(F)(F)F)(O)O |
Computed by PubChem (NCBI)