Products 1254691-84-3

CAS 1254691-84-3 is the registry number for Pranoprofen Impurity 42. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 2-phenoxypyridine-3-carboxylate (CAS 1254691-84-3) is a chemical compound with the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. IUPAC name: ethyl 2-phenoxypyridine-3-carboxylate. InChIKey: UZNIOOCTUGNFPD-UHFFFAOYSA-N.

Identity
Molecular formulaC14H13NO3
Molecular weight243.26 g/mol
IUPAC nameethyl 2-phenoxypyridine-3-carboxylate
InChIKeyUZNIOOCTUGNFPD-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(N=CC=C1)OC2=CC=CC=C2

Computed by PubChem (NCBI)