Products 1255099-55-8

CAS 1255099-55-8 is the registry number for Ethyl 1-amino-2-ethylcyclopropanecarboxylate hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g, 10g.

Ethyl 1-amino-2-ethylcyclopropane-1-carboxylate;hydrochloride (CAS 1255099-55-8) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: ethyl 1-amino-2-ethylcyclopropane-1-carboxylate;hydrochloride. InChIKey: URJFFPOICMEAON-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16ClNO2
Molecular weight193.67 g/mol
IUPAC nameethyl 1-amino-2-ethylcyclopropane-1-carboxylate;hydrochloride
InChIKeyURJFFPOICMEAON-UHFFFAOYSA-N
SMILESCCC1CC1(C(=O)OCC)N.Cl

Computed by PubChem (NCBI)