Products 1255306-40-1
CAS 1255306-40-1 is the registry number for 1-Benzylcyclobutan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-benzylcyclobutan-1-amine;hydrochloride (CAS 1255306-40-1) is a chemical compound with the molecular formula C11H16ClN and a molecular weight of 197.70 g/mol. IUPAC name: 1-benzylcyclobutan-1-amine;hydrochloride. InChIKey: UYCQOWBTPGTYGH-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN |
|---|---|
| Molecular weight | 197.70 g/mol |
| IUPAC name | 1-benzylcyclobutan-1-amine;hydrochloride |
| InChIKey | UYCQOWBTPGTYGH-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(CC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
1-benzylcyclobutan-1-amine hydrochloride, 1-Benzylcyclobutanamine hydrochloride, 1-Benzyl-cyclobutylamine hydrochloride, 1-benzylcyclobutan-1-amine;hydrochloride, 1-Benzylcyclobutanaminehydrochloride, 1-benzylcyclobutanamine;hydrochloride, 1-Benzylcyclobutan-1-amine--hydrogen chloride (1/1)