CAS 1255717-50-0 appears in our catalog under these names: ([1-(4-Fluorophenyl)-1h-pyrazol-4-yl]methyl)methylamine hydrochloride, 95%, {(1-(4-Fluorophenyl)-1H-pyrazol-4-yl)methyl}methylamine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 25g, 10g, 50g, 5g, 1g.
1-[1-(4-fluorophenyl)pyrazol-4-yl]-N-methylmethanamine;hydrochloride (CAS 1255717-50-0) is a chemical compound with the molecular formula C11H13ClFN3 and a molecular weight of 241.69 g/mol. IUPAC name: 1-[1-(4-fluorophenyl)pyrazol-4-yl]-N-methylmethanamine;hydrochloride. InChIKey: SHVFAGKIZYSRFA-UHFFFAOYSA-N.
| Molecular formula | C11H13ClFN3 |
|---|---|
| Molecular weight | 241.69 g/mol |
| IUPAC name | 1-[1-(4-fluorophenyl)pyrazol-4-yl]-N-methylmethanamine;hydrochloride |
| InChIKey | SHVFAGKIZYSRFA-UHFFFAOYSA-N |
| SMILES | CNCC1=CN(N=C1)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)