Products 1439896-63-5
CAS 1439896-63-5 appears in our catalog under these names: [1-(2-Fluorobenzyl)-1h-imidazol-4-yl]methanamine hydrochloride, 95%, (1-(2-Fluorobenzyl)-1H-imidazol-4-yl)methanamine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
[1-[(2-fluorophenyl)methyl]imidazol-4-yl]methanamine;hydrochloride (CAS 1439896-63-5) is a chemical compound with the molecular formula C11H13ClFN3 and a molecular weight of 241.69 g/mol. IUPAC name: [1-[(2-fluorophenyl)methyl]imidazol-4-yl]methanamine;hydrochloride. InChIKey: DICBGMGRHTUMKK-UHFFFAOYSA-N.
| Molecular formula | C11H13ClFN3 |
|---|---|
| Molecular weight | 241.69 g/mol |
| IUPAC name | [1-[(2-fluorophenyl)methyl]imidazol-4-yl]methanamine;hydrochloride |
| InChIKey | DICBGMGRHTUMKK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C=C(N=C2)CN)F.Cl |
Computed by PubChem (NCBI)