CAS 1707584-12-0 is the registry number for [1-(2-Fluorobenzyl)-1h-imidazol-5-yl]methanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
[3-[(2-fluorophenyl)methyl]imidazol-4-yl]methanamine;hydrochloride (CAS 1707584-12-0) is a chemical compound with the molecular formula C11H13ClFN3 and a molecular weight of 241.69 g/mol. IUPAC name: [3-[(2-fluorophenyl)methyl]imidazol-4-yl]methanamine;hydrochloride. InChIKey: FIJSUTMCZVJYDL-UHFFFAOYSA-N.
| Molecular formula | C11H13ClFN3 |
|---|---|
| Molecular weight | 241.69 g/mol |
| IUPAC name | [3-[(2-fluorophenyl)methyl]imidazol-4-yl]methanamine;hydrochloride |
| InChIKey | FIJSUTMCZVJYDL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C=NC=C2CN)F.Cl |
Computed by PubChem (NCBI)