Products 2490705-29-6
CAS 2490705-29-6 appears in our catalog under these names: 2-(4-Fluorophenyl)-2-(1H-pyrazol-1-yl)ethan-1-amine hydrochloride, 95%, 2-(4-Fluorophenyl)-2-(1H-pyrazol-1-yl)ethan-1-amine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg.
2-(4-fluorophenyl)-2-pyrazol-1-ylethanamine;hydrochloride (CAS 2490705-29-6) is a chemical compound with the molecular formula C11H13ClFN3 and a molecular weight of 241.69 g/mol. IUPAC name: 2-(4-fluorophenyl)-2-pyrazol-1-ylethanamine;hydrochloride. InChIKey: IURQZLOJIXBHBI-UHFFFAOYSA-N.
| Molecular formula | C11H13ClFN3 |
|---|---|
| Molecular weight | 241.69 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-2-pyrazol-1-ylethanamine;hydrochloride |
| InChIKey | IURQZLOJIXBHBI-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C(CN)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)