CAS 1255718-18-3 is the registry number for [1-(4-Isopropyl-4h-1,2,4-triazol-3-yl)ethyl]amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-(4-propan-2-yl-1,2,4-triazol-3-yl)ethanamine;dihydrochloride (CAS 1255718-18-3) is a chemical compound with the molecular formula C7H16Cl2N4 and a molecular weight of 227.13 g/mol. IUPAC name: 1-(4-propan-2-yl-1,2,4-triazol-3-yl)ethanamine;dihydrochloride. InChIKey: XRHWWCAVKZXXBK-UHFFFAOYSA-N.
| Molecular formula | C7H16Cl2N4 |
|---|---|
| Molecular weight | 227.13 g/mol |
| IUPAC name | 1-(4-propan-2-yl-1,2,4-triazol-3-yl)ethanamine;dihydrochloride |
| InChIKey | XRHWWCAVKZXXBK-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=NN=C1C(C)N.Cl.Cl |
Computed by PubChem (NCBI)