CAS 2344680-74-4 is the registry number for 2-(5-(Propan-2-yl)-1H-1,2,4-triazol-3-yl)ethan-1-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine;dihydrochloride (CAS 2344680-74-4) is a chemical compound with the molecular formula C7H16Cl2N4 and a molecular weight of 227.13 g/mol. IUPAC name: 2-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine;dihydrochloride. InChIKey: XCMLUIWXCVNESB-UHFFFAOYSA-N.
| Molecular formula | C7H16Cl2N4 |
|---|---|
| Molecular weight | 227.13 g/mol |
| IUPAC name | 2-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine;dihydrochloride |
| InChIKey | XCMLUIWXCVNESB-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NNC(=N1)CCN.Cl.Cl |
Computed by PubChem (NCBI)