Products 1909328-09-1
CAS 1909328-09-1 is the registry number for 1-[2-(dimethylamino)ethyl]-1h-pyrazol-4-amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
1-[2-(dimethylamino)ethyl]pyrazol-4-amine;dihydrochloride (CAS 1909328-09-1) is a chemical compound with the molecular formula C7H16Cl2N4 and a molecular weight of 227.13 g/mol. IUPAC name: 1-[2-(dimethylamino)ethyl]pyrazol-4-amine;dihydrochloride. InChIKey: DWWJIAYCYJREFA-UHFFFAOYSA-N.
| Molecular formula | C7H16Cl2N4 |
|---|---|
| Molecular weight | 227.13 g/mol |
| IUPAC name | 1-[2-(dimethylamino)ethyl]pyrazol-4-amine;dihydrochloride |
| InChIKey | DWWJIAYCYJREFA-UHFFFAOYSA-N |
| SMILES | CN(C)CCN1C=C(C=N1)N.Cl.Cl |
Computed by PubChem (NCBI)