CAS 1788732-90-0 appears in our catalog under these names: N1-(1,3-Dimethyl-1H-pyrazol-5-yl)ethane-1,2-diamine dihydrochloride, 95%, N-(2-Aminoethyl)-1,3-dimethyl-1H-pyrazol-5-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
N'-(2,5-dimethylpyrazol-3-yl)ethane-1,2-diamine;dihydrochloride (CAS 1788732-90-0) is a chemical compound with the molecular formula C7H16Cl2N4 and a molecular weight of 227.13 g/mol. IUPAC name: N'-(2,5-dimethylpyrazol-3-yl)ethane-1,2-diamine;dihydrochloride. InChIKey: ARBOPZVRJCQZPR-UHFFFAOYSA-N.
| Molecular formula | C7H16Cl2N4 |
|---|---|
| Molecular weight | 227.13 g/mol |
| IUPAC name | N'-(2,5-dimethylpyrazol-3-yl)ethane-1,2-diamine;dihydrochloride |
| InChIKey | ARBOPZVRJCQZPR-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)NCCN)C.Cl.Cl |
Computed by PubChem (NCBI)