Products 1256346-09-4

CAS 1256346-09-4 is the registry number for 5-Butoxy-2-chlorophenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

(5-butoxy-2-chlorophenyl)boronic acid (CAS 1256346-09-4) is a chemical compound with the molecular formula C10H14BClO3 and a molecular weight of 228.48 g/mol. IUPAC name: (5-butoxy-2-chlorophenyl)boronic acid. InChIKey: DCSNETLHXULGKD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14BClO3
Molecular weight228.48 g/mol
IUPAC name(5-butoxy-2-chlorophenyl)boronic acid
InChIKeyDCSNETLHXULGKD-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1)OCCCC)Cl)(O)O

Computed by PubChem (NCBI)