Products 480438-55-9
CAS 480438-55-9 appears in our catalog under these names: (4-Butoxy-3-chlorophenyl)boronic acid 95%, 4-Butoxy-3-Chlorophenylboronic Acid, 95%, 95%, (4-Butoxy-3-chlorophenyl)boronic acid, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g.
(4-butoxy-3-chlorophenyl)boronic acid (CAS 480438-55-9) is a chemical compound with the molecular formula C10H14BClO3 and a molecular weight of 228.48 g/mol. IUPAC name: (4-butoxy-3-chlorophenyl)boronic acid. InChIKey: AOKJNAVCTPBFPJ-UHFFFAOYSA-N.
| Molecular formula | C10H14BClO3 |
|---|---|
| Molecular weight | 228.48 g/mol |
| IUPAC name | (4-butoxy-3-chlorophenyl)boronic acid |
| InChIKey | AOKJNAVCTPBFPJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCCCC)Cl)(O)O |
Computed by PubChem (NCBI)