CAS 2377991-41-6 is the registry number for 2-(2-Chlorofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-chlorofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2377991-41-6) is a chemical compound with the molecular formula C10H14BClO3 and a molecular weight of 228.48 g/mol. IUPAC name: 2-(2-chlorofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FZSQBJAOHXVMSZ-UHFFFAOYSA-N.
| Molecular formula | C10H14BClO3 |
|---|---|
| Molecular weight | 228.48 g/mol |
| IUPAC name | 2-(2-chlorofuran-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FZSQBJAOHXVMSZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(OC=C2)Cl |
Computed by PubChem (NCBI)