Products 352534-88-4
CAS 352534-88-4 appears in our catalog under these names: 2-Butoxy-5-chlorophenylboronic acid, 98%, (2-Butoxy-5-chlorophenyl)boronic acid 98%, (2-Butoxy-5-chlorophenyl)boronic acid, 98%, 98%, (2-Butoxy-5-chlorophenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
(2-butoxy-5-chlorophenyl)boronic acid (CAS 352534-88-4) is a chemical compound with the molecular formula C10H14BClO3 and a molecular weight of 228.48 g/mol. IUPAC name: (2-butoxy-5-chlorophenyl)boronic acid. InChIKey: GGIBHUXEZCJVCZ-UHFFFAOYSA-N.
| Molecular formula | C10H14BClO3 |
|---|---|
| Molecular weight | 228.48 g/mol |
| IUPAC name | (2-butoxy-5-chlorophenyl)boronic acid |
| InChIKey | GGIBHUXEZCJVCZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)OCCCC)(O)O |
Computed by PubChem (NCBI)