CAS 1256359-10-0 appears in our catalog under these names: 4-Methyl-2-nitrophenylboronic acid, pinacol ester, 98%, 4-Methyl-2-nitrophenylboronic acid pinacol ester, 4,4,5,5-Tetramethyl-2-(4-methyl-2-nitrophenyl)-1,3,2-dioxaborolane, ≥95%, 4-Methyl-2-nitrophenylboronic acid pinacol ester, 98%. Offered by: Combi-blocks, Biosynth, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 0,5g, 50mg, 100mg, 500mg.
4,4,5,5-tetramethyl-2-(4-methyl-2-nitrophenyl)-1,3,2-dioxaborolane (CAS 1256359-10-0) is a chemical compound with the molecular formula C13H18BNO4 and a molecular weight of 263.10 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-methyl-2-nitrophenyl)-1,3,2-dioxaborolane. InChIKey: RDJAHMNUDOAUSC-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO4 |
|---|---|
| Molecular weight | 263.10 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-methyl-2-nitrophenyl)-1,3,2-dioxaborolane |
| InChIKey | RDJAHMNUDOAUSC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)