CAS 1256482-47-9 appears in our catalog under these names: Ethyl 2-(4-fluoro-3,5-dimethylphenyl)-2-oxoacetate, 95%, 95%, (4-Fluoro-3,5-dimethylphenyl)oxoacetic acid ethyl ester, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 2-(4-fluoro-3,5-dimethylphenyl)-2-oxoacetate (CAS 1256482-47-9) is a chemical compound with the molecular formula C12H13FO3 and a molecular weight of 224.23 g/mol. IUPAC name: ethyl 2-(4-fluoro-3,5-dimethylphenyl)-2-oxoacetate. InChIKey: MYQNHGKWJJMZHB-UHFFFAOYSA-N.
| Molecular formula | C12H13FO3 |
|---|---|
| Molecular weight | 224.23 g/mol |
| IUPAC name | ethyl 2-(4-fluoro-3,5-dimethylphenyl)-2-oxoacetate |
| InChIKey | MYQNHGKWJJMZHB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=CC(=C(C(=C1)C)F)C |
Computed by PubChem (NCBI)