Products 1256794-75-8
CAS 1256794-75-8 appears in our catalog under these names: 3-(Difluoromethyl)pyridine-2-carboxylic acid, 97%, 3-(Difluoromethyl)pyridine-2-carboxylic acid, 3-(difluoromethyl)pyridine-2-carboxylic acid, 95%, 95%, 3-(Difluoromethyl)picolinic acid, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg.
3-(difluoromethyl)pyridine-2-carboxylic acid (CAS 1256794-75-8) is a chemical compound with the molecular formula C7H5F2NO2 and a molecular weight of 173.12 g/mol. IUPAC name: 3-(difluoromethyl)pyridine-2-carboxylic acid. InChIKey: YSKFTQKVLHFVKA-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO2 |
|---|---|
| Molecular weight | 173.12 g/mol |
| IUPAC name | 3-(difluoromethyl)pyridine-2-carboxylic acid |
| InChIKey | YSKFTQKVLHFVKA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C(=O)O)C(F)F |
Computed by PubChem (NCBI)