Products 1256818-71-9
CAS 1256818-71-9 is the registry number for 4-Bromo-2-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine, 98%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
4-bromo-2-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine (CAS 1256818-71-9) is a chemical compound with the molecular formula C8H4BrF3N2 and a molecular weight of 265.03 g/mol. IUPAC name: 4-bromo-2-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine. InChIKey: KGQCJUOLKGWKSW-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3N2 |
|---|---|
| Molecular weight | 265.03 g/mol |
| IUPAC name | 4-bromo-2-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | KGQCJUOLKGWKSW-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=C1Br)C=C(N2)C(F)(F)F |
Computed by PubChem (NCBI)