Products 1256822-73-7

CAS 1256822-73-7 is the registry number for 2-Chloro-5-ethylisonicotinic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-chloro-5-ethylpyridine-4-carboxylic acid (CAS 1256822-73-7) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: 2-chloro-5-ethylpyridine-4-carboxylic acid. InChIKey: ITWDITAPVOQSIA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClNO2
Molecular weight185.61 g/mol
IUPAC name2-chloro-5-ethylpyridine-4-carboxylic acid
InChIKeyITWDITAPVOQSIA-UHFFFAOYSA-N
SMILESCCC1=CN=C(C=C1C(=O)O)Cl

Computed by PubChem (NCBI)