CAS 1256822-91-9 appears in our catalog under these names: 3-(2-Chloropyridin-3-yl)propanoic acid, 95%, 3-(2-Chloropyridin-3-yl)propanoic acid, 2-Chloro-3-pyridinepropanoic acid, 95%, 95%, 2-Chloro-3-pyridinepropanoic acid, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
3-(2-chloro-3-pyridinyl)propanoic acid (CAS 1256822-91-9) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: 3-(2-chloro-3-pyridinyl)propanoic acid. InChIKey: FXKNTJOROSPHDO-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 3-(2-chloro-3-pyridinyl)propanoic acid |
| InChIKey | FXKNTJOROSPHDO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)Cl)CCC(=O)O |
Computed by PubChem (NCBI)