Products 1256834-70-4
CAS 1256834-70-4 is the registry number for 3-(6-Chloropyridin-2-yl)propanoic acid, 98%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
3-(6-chloro-2-pyridinyl)propanoic acid (CAS 1256834-70-4) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: 3-(6-chloro-2-pyridinyl)propanoic acid. InChIKey: AMAFBIGWLTUGHI-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 3-(6-chloro-2-pyridinyl)propanoic acid |
| InChIKey | AMAFBIGWLTUGHI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Cl)CCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(6-chloropyridin-2-yl)propanoic acid