Products 1256836-49-3
CAS 1256836-49-3 is the registry number for 1-(6-Bromo-2-chloropyridin-3-yl)ethanone, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
1-(6-bromo-2-chloro-3-pyridinyl)ethanone (CAS 1256836-49-3) is a chemical compound with the molecular formula C7H5BrClNO and a molecular weight of 234.48 g/mol. IUPAC name: 1-(6-bromo-2-chloro-3-pyridinyl)ethanone. InChIKey: XFYIKVLWAHRLFS-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO |
|---|---|
| Molecular weight | 234.48 g/mol |
| IUPAC name | 1-(6-bromo-2-chloro-3-pyridinyl)ethanone |
| InChIKey | XFYIKVLWAHRLFS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(N=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)