CAS 125709-98-0 appears in our catalog under these names: 7-Hydroxy-4,8-dimethyl-1,2-dihydroquinolin-2-one, 95%, 7-Hydroxy-4,8-dimethyl-1,2-dihydroquinolin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
7-hydroxy-4,8-dimethyl-1H-quinolin-2-one (CAS 125709-98-0) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 7-hydroxy-4,8-dimethyl-1H-quinolin-2-one. InChIKey: ACKDRTHLZVLFJX-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 7-hydroxy-4,8-dimethyl-1H-quinolin-2-one |
| InChIKey | ACKDRTHLZVLFJX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC2=C1C=CC(=C2C)O |
Computed by PubChem (NCBI)