CAS 1257220-47-5 appears in our catalog under these names: 5,7–Dihydro–7,7–dimethyl–indeno(2,1–b)carbazole, 7,7-Dimethyl-5,7-dihydroindeno[2,1-b]carbazole, 98%, 98%, 7,7-Dimethyl-5,7-dihydroindeno[2,1-b]carbazole, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 50g, 5g, 250mg, 25g, 100g, 10g.
7,7-dimethyl-5H-indeno[2,1-b]carbazole (CAS 1257220-47-5) is a chemical compound with the molecular formula C21H17N and a molecular weight of 283.4 g/mol. IUPAC name: 7,7-dimethyl-5H-indeno[2,1-b]carbazole. InChIKey: UAVZDBIKIOWDQF-UHFFFAOYSA-N.
| Molecular formula | C21H17N |
|---|---|
| Molecular weight | 283.4 g/mol |
| IUPAC name | 7,7-dimethyl-5H-indeno[2,1-b]carbazole |
| InChIKey | UAVZDBIKIOWDQF-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C4C(=C3)C5=CC=CC=C5N4)C |
Computed by PubChem (NCBI)