CAS 1329054-41-2 is the registry number for 12,12-dimethyl-11,12-dihydroindeno(2,1-a)carbazole12,12-dimethyl-11,12-dihydroindeno(2,1-a)carbazole, >98% (HPLC). Offered by: Lumtec. Available pack sizes: On request.
12,12-dimethyl-11H-indeno[2,1-a]carbazole (CAS 1329054-41-2) is a chemical compound with the molecular formula C21H17N and a molecular weight of 283.4 g/mol. IUPAC name: 12,12-dimethyl-11H-indeno[2,1-a]carbazole. InChIKey: OYDSLVZYTZULNO-UHFFFAOYSA-N.
| Molecular formula | C21H17N |
|---|---|
| Molecular weight | 283.4 g/mol |
| IUPAC name | 12,12-dimethyl-11H-indeno[2,1-a]carbazole |
| InChIKey | OYDSLVZYTZULNO-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C4=C(C=C3)C5=CC=CC=C5N4)C |
Computed by PubChem (NCBI)