CAS 1346645-54-2 appears in our catalog under these names: 12,12-Dimethyl-5,12-dihydroindeno[1,2-c]carbazole, 98%, 5,12-Dihydro-12,12-dimethylindeno[1,2-c]carbazole, ≥98%, ≥98%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 250mg, 1g.
12,12-dimethyl-5H-indeno[1,2-c]carbazole (CAS 1346645-54-2) is a chemical compound with the molecular formula C21H17N and a molecular weight of 283.4 g/mol. IUPAC name: 12,12-dimethyl-5H-indeno[1,2-c]carbazole. InChIKey: KTNNVYIMEPONFW-UHFFFAOYSA-N.
| Molecular formula | C21H17N |
|---|---|
| Molecular weight | 283.4 g/mol |
| IUPAC name | 12,12-dimethyl-5H-indeno[1,2-c]carbazole |
| InChIKey | KTNNVYIMEPONFW-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C4=C(C=C3)NC5=CC=CC=C54)C |
Computed by PubChem (NCBI)