CAS 1393444-80-8 is the registry number for 5-(Diphenylmethyl)-1H-indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
5-benzhydryl-1H-indole (CAS 1393444-80-8) is a chemical compound with the molecular formula C21H17N and a molecular weight of 283.4 g/mol. IUPAC name: 5-benzhydryl-1H-indole. InChIKey: RURBBCARGCGHGM-UHFFFAOYSA-N.
| Molecular formula | C21H17N |
|---|---|
| Molecular weight | 283.4 g/mol |
| IUPAC name | 5-benzhydryl-1H-indole |
| InChIKey | RURBBCARGCGHGM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C3=CC4=C(C=C3)NC=C4 |
Computed by PubChem (NCBI)