Products 1707567-81-4

CAS 1707567-81-4 is the registry number for 1-((Ethylsulfonyl)methyl)cyclopropane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-(ethylsulfonylmethyl)cyclopropane-1-carboxylic acid (CAS 1707567-81-4) is a chemical compound with the molecular formula C7H12O4S and a molecular weight of 192.24 g/mol. IUPAC name: 1-(ethylsulfonylmethyl)cyclopropane-1-carboxylic acid. InChIKey: DFRHMLLORPBRPI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12O4S
Molecular weight192.24 g/mol
IUPAC name1-(ethylsulfonylmethyl)cyclopropane-1-carboxylic acid
InChIKeyDFRHMLLORPBRPI-UHFFFAOYSA-N
SMILESCCS(=O)(=O)CC1(CC1)C(=O)O

Computed by PubChem (NCBI)