CAS 1257293-65-4 is the registry number for 3-(1,1-Dioxo-1-thiomorpholine-4-yl)azetidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
Tert-butyl 3-(1,1-dioxo-1,4-thiazinan-4-yl)azetidine-1-carboxylate (CAS 1257293-65-4) is a chemical compound with the molecular formula C12H22N2O4S and a molecular weight of 290.38 g/mol. IUPAC name: tert-butyl 3-(1,1-dioxo-1,4-thiazinan-4-yl)azetidine-1-carboxylate. InChIKey: VTLZFUQRXCVISU-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O4S |
|---|---|
| Molecular weight | 290.38 g/mol |
| IUPAC name | tert-butyl 3-(1,1-dioxo-1,4-thiazinan-4-yl)azetidine-1-carboxylate |
| InChIKey | VTLZFUQRXCVISU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)N2CCS(=O)(=O)CC2 |
Computed by PubChem (NCBI)