CAS 2344681-17-8 appears in our catalog under these names: tert-Butyl 2-thia-3,8-diazaspiro(4.5)decane-8-carboxylate 2,2-dioxide, 98%, tert-Butyl 2,2-dioxo-2λ6-thia-3,8-diazaspiro(4.5)decane-8-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Tert-butyl 2,2-dioxo-2lambda6-thia-3,8-diazaspiro[4.5]decane-8-carboxylate (CAS 2344681-17-8) is a chemical compound with the molecular formula C12H22N2O4S and a molecular weight of 290.38 g/mol. IUPAC name: tert-butyl 2,2-dioxo-2lambda6-thia-3,8-diazaspiro[4.5]decane-8-carboxylate. InChIKey: ZPDHIPOWAHMJLI-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O4S |
|---|---|
| Molecular weight | 290.38 g/mol |
| IUPAC name | tert-butyl 2,2-dioxo-2lambda6-thia-3,8-diazaspiro[4.5]decane-8-carboxylate |
| InChIKey | ZPDHIPOWAHMJLI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CNS(=O)(=O)C2 |
Computed by PubChem (NCBI)