CAS 2376607-39-3 is the registry number for tert-Butyl 8-(methylsulfonyl)-3,8-diazabicyclo[3.2.1]octane-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 8-methylsulfonyl-3,8-diazabicyclo[3.2.1]octane-3-carboxylate (CAS 2376607-39-3) is a chemical compound with the molecular formula C12H22N2O4S and a molecular weight of 290.38 g/mol. IUPAC name: tert-butyl 8-methylsulfonyl-3,8-diazabicyclo[3.2.1]octane-3-carboxylate. InChIKey: CQVYJCNOGNNAKY-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O4S |
|---|---|
| Molecular weight | 290.38 g/mol |
| IUPAC name | tert-butyl 8-methylsulfonyl-3,8-diazabicyclo[3.2.1]octane-3-carboxylate |
| InChIKey | CQVYJCNOGNNAKY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CCC(C1)N2S(=O)(=O)C |
Computed by PubChem (NCBI)