CAS 2225137-19-7 is the registry number for tert-Butyl 3-amino-1,1-dioxo-1λ6-thia-7-azaspiro(3.5)nonane-7-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 3-amino-1,1-dioxo-1lambda6-thia-7-azaspiro[3.5]nonane-7-carboxylate (CAS 2225137-19-7) is a chemical compound with the molecular formula C12H22N2O4S and a molecular weight of 290.38 g/mol. IUPAC name: tert-butyl 3-amino-1,1-dioxo-1lambda6-thia-7-azaspiro[3.5]nonane-7-carboxylate. InChIKey: RZGVKFILRYSQAF-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O4S |
|---|---|
| Molecular weight | 290.38 g/mol |
| IUPAC name | tert-butyl 3-amino-1,1-dioxo-1lambda6-thia-7-azaspiro[3.5]nonane-7-carboxylate |
| InChIKey | RZGVKFILRYSQAF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)C(CS2(=O)=O)N |
Computed by PubChem (NCBI)