Products 1257585-21-9
CAS 1257585-21-9 is the registry number for 4-(Aminomethyl)-N-(pyridin-2-ylmethyl)benzamide hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(aminomethyl)-N-(pyridin-2-ylmethyl)benzamide;hydrochloride (CAS 1257585-21-9) is a chemical compound with the molecular formula C14H16ClN3O and a molecular weight of 277.75 g/mol. IUPAC name: 4-(aminomethyl)-N-(pyridin-2-ylmethyl)benzamide;hydrochloride. InChIKey: YNTDFKQXCUTKTB-UHFFFAOYSA-N.
| Molecular formula | C14H16ClN3O |
|---|---|
| Molecular weight | 277.75 g/mol |
| IUPAC name | 4-(aminomethyl)-N-(pyridin-2-ylmethyl)benzamide;hydrochloride |
| InChIKey | YNTDFKQXCUTKTB-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CNC(=O)C2=CC=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)