CAS 1257832-55-5 is the registry number for 3-Methoxy-4-(2,2,2-trifluoroethyl)aniline. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg.
3-methoxy-4-(2,2,2-trifluoroethyl)aniline (CAS 1257832-55-5) is a chemical compound with the molecular formula C9H10F3NO and a molecular weight of 205.18 g/mol. IUPAC name: 3-methoxy-4-(2,2,2-trifluoroethyl)aniline. InChIKey: FMHRCTHQHSPIEI-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | 3-methoxy-4-(2,2,2-trifluoroethyl)aniline |
| InChIKey | FMHRCTHQHSPIEI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N)CC(F)(F)F |
Computed by PubChem (NCBI)