Products 1257842-91-3
CAS 1257842-91-3 is the registry number for 4-(3,5-Dimethyl-1h-pyrazol-4-ylmethyl)-5-methyl-isoxazole-3-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
4-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-5-methyl-1,2-oxazole-3-carboxylic acid;hydrochloride (CAS 1257842-91-3) is a chemical compound with the molecular formula C11H14ClN3O3 and a molecular weight of 271.70 g/mol. IUPAC name: 4-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-5-methyl-1,2-oxazole-3-carboxylic acid;hydrochloride. InChIKey: GEADKNCILUJRNH-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O3 |
|---|---|
| Molecular weight | 271.70 g/mol |
| IUPAC name | 4-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-5-methyl-1,2-oxazole-3-carboxylic acid;hydrochloride |
| InChIKey | GEADKNCILUJRNH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)CC2=C(ON=C2C(=O)O)C.Cl |
Computed by PubChem (NCBI)