CAS 1573052-56-8 appears in our catalog under these names: 1-(2-Nitrobenzoyl)piperazine hydrochloride, 95%, 1-(2-Nitrobenzoyl)piperazine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
(2-nitrophenyl)-piperazin-1-ylmethanone;hydrochloride (CAS 1573052-56-8) is a chemical compound with the molecular formula C11H14ClN3O3 and a molecular weight of 271.70 g/mol. IUPAC name: (2-nitrophenyl)-piperazin-1-ylmethanone;hydrochloride. InChIKey: JKQOVCPLCNDLBQ-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O3 |
|---|---|
| Molecular weight | 271.70 g/mol |
| IUPAC name | (2-nitrophenyl)-piperazin-1-ylmethanone;hydrochloride |
| InChIKey | JKQOVCPLCNDLBQ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=CC=CC=C2[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)