CAS 1803562-82-4 is the registry number for 3-(3-Aminophenyl)-5-(methoxymethyl)imidazolidine-2,4-dione hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-(3-aminophenyl)-5-(methoxymethyl)imidazolidine-2,4-dione;hydrochloride (CAS 1803562-82-4) is a chemical compound with the molecular formula C11H14ClN3O3 and a molecular weight of 271.70 g/mol. IUPAC name: 3-(3-aminophenyl)-5-(methoxymethyl)imidazolidine-2,4-dione;hydrochloride. InChIKey: OSAWBVDDCHHIRS-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O3 |
|---|---|
| Molecular weight | 271.70 g/mol |
| IUPAC name | 3-(3-aminophenyl)-5-(methoxymethyl)imidazolidine-2,4-dione;hydrochloride |
| InChIKey | OSAWBVDDCHHIRS-UHFFFAOYSA-N |
| SMILES | COCC1C(=O)N(C(=O)N1)C2=CC=CC(=C2)N.Cl |
Computed by PubChem (NCBI)